C25H42O4 — CID 11795647
methyl (2S)-2-[(3S,6R)-6-methyl-6-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]dioxan-3-yl]propanoate (PubChem CID 11795647) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is methyl (2S)-2-[(3S,6R)-6-methyl-6-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]dioxan-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3S,6R)-6-methyl-6-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]dioxan-3-yl]propanoate |
|---|---|
| PubChem CID | 11795647 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | methyl (2S)-2-[(3S,6R)-6-methyl-6-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]dioxan-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OO1 |
| InChI | InChI=1S/C25H42O4/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-17-25(6)18-16-23(28-29-25)22(5)24(26)27-7/h11,13,15,22-23H,8-10,12,14,16-18H2,1-7H3/b20-13+,21-15+/t22-,23-,25+/m0/s1 |
| InChIKey | LCYOYORSUQYOEM-BIPLRLLMSA-N |
| XLogP | 6.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|