C20H32O4 — CID 10359661
methyl (9R)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-1,4-dioxaspiro[4.4]nonane-9-carboxylate (PubChem CID 10359661) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is methyl (9R)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-1,4-dioxaspiro[4.4]nonane-9-carboxylate.
| Compound Name | methyl (9R)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-1,4-dioxaspiro[4.4]nonane-9-carboxylate |
|---|---|
| PubChem CID | 10359661 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | methyl (9R)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-1,4-dioxaspiro[4.4]nonane-9-carboxylate |
| SMILES | COC(=O)[C@@]1(CC/C=C(\C)CCC=C(C)C)CCCC12OCCO2 |
| InChI | InChI=1S/C20H32O4/c1-16(2)8-5-9-17(3)10-6-11-19(18(21)22-4)12-7-13-20(19)23-14-15-24-20/h8,10H,5-7,9,11-15H2,1-4H3/b17-10+/t19-/m1/s1 |
| InChIKey | ZECOPSYQKNONTK-RPXHZFJKSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|