C15H24O7 — CID 178105451
methyl 6-(4-methoxy-4-oxobutoxy)-1,4-dioxaspiro[4.5]decane-6-carboxylate (PubChem CID 178105451) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 6-(4-methoxy-4-oxobutoxy)-1,4-dioxaspiro[4.5]decane-6-carboxylate.
| Compound Name | methyl 6-(4-methoxy-4-oxobutoxy)-1,4-dioxaspiro[4.5]decane-6-carboxylate |
|---|---|
| PubChem CID | 178105451 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl 6-(4-methoxy-4-oxobutoxy)-1,4-dioxaspiro[4.5]decane-6-carboxylate |
| SMILES | COC(=O)CCCOC1(C(=O)OC)CCCCC12OCCO2 |
| InChI | InChI=1S/C15H24O7/c1-18-12(16)6-5-9-20-14(13(17)19-2)7-3-4-8-15(14)21-10-11-22-15/h3-11H2,1-2H3 |
| InChIKey | BMJKAZBJFUTZBA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|