C10H14O — CID 86257426
2-methyl-1,3a,4,6,7,7a-hexahydroinden-5-one (PubChem CID 86257426) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-1,3a,4,6,7,7a-hexahydroinden-5-one.
| Compound Name | 2-methyl-1,3a,4,6,7,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 86257426 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-methyl-1,3a,4,6,7,7a-hexahydroinden-5-one |
| SMILES | CC1=CC2CC(=O)CCC2C1 |
| InChI | InChI=1S/C10H14O/c1-7-4-8-2-3-10(11)6-9(8)5-7/h5,8-9H,2-4,6H2,1H3 |
| InChIKey | WOGKUYIIOLCBMT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|