C10H14O — CID 102053101
(4aR,8aS)-3,4,4a,5,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 102053101) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (4aR,8aS)-3,4,4a,5,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,8aS)-3,4,4a,5,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 102053101 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (4aR,8aS)-3,4,4a,5,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | O=C1CC[C@@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C10H14O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-2,8-9H,3-7H2/t8-,9-/m0/s1 |
| InChIKey | XTACKJBESZJGJZ-IUCAKERBSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|