C10H16O — CID 14063354
(4Z)-4,6-dimethylcyclooct-4-en-1-one (PubChem CID 14063354) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (4Z)-4,6-dimethylcyclooct-4-en-1-one.
| Compound Name | (4Z)-4,6-dimethylcyclooct-4-en-1-one |
|---|---|
| PubChem CID | 14063354 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (4Z)-4,6-dimethylcyclooct-4-en-1-one |
| SMILES | C/C1=C/C(C)CCC(=O)CC1 |
| InChI | InChI=1S/C10H16O/c1-8-3-5-10(11)6-4-9(2)7-8/h7-8H,3-6H2,1-2H3/b9-7- |
| InChIKey | MZEKGIJRNLSVID-CLFYSBASSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|