C26H24O4 — CID 125035166
(4aR,8aS,12aS,16aS)-4a,5,6,7,8,8a,12a,13,14,15,16,16a-dodecahydrohexacene-1,4,9,12-tetrone (PubChem CID 125035166) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is (4aR,8aS,12aS,16aS)-4a,5,6,7,8,8a,12a,13,14,15,16,16a-dodecahydrohexacene-1,4,9,12-tetrone.
| Compound Name | (4aR,8aS,12aS,16aS)-4a,5,6,7,8,8a,12a,13,14,15,16,16a-dodecahydrohexacene-1,4,9,12-tetrone |
|---|---|
| PubChem CID | 125035166 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (4aR,8aS,12aS,16aS)-4a,5,6,7,8,8a,12a,13,14,15,16,16a-dodecahydrohexacene-1,4,9,12-tetrone |
| SMILES | O=C1C=CC(=O)[C@H]2CC3=C(CC4=C(C3)CC3=C(C4)C[C@@H]4C(=O)C=CC(=O)[C@@H]4C3)C[C@H]12 |
| InChI | InChI=1S/C26H24O4/c27-23-1-2-24(28)20-10-16-6-14-8-18-12-22-21(25(29)3-4-26(22)30)11-17(18)7-13(14)5-15(16)9-19(20)23/h1-4,19-22H,5-12H2/t19-,20-,21-,22+/m0/s1 |
| InChIKey | NXBLOLIOKMGRLM-MYGLTJDJSA-N |
| XLogP | 3.93 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|