C19H21NO3S — CID 135018497
(NE)-N-(6,7-dimethyl-4-oxo-4a,5,8,8a-tetrahydronaphthalen-1-ylidene)-4-methylbenzenesulfonamide (PubChem CID 135018497) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (NE)-N-(6,7-dimethyl-4-oxo-4a,5,8,8a-tetrahydronaphthalen-1-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-(6,7-dimethyl-4-oxo-4a,5,8,8a-tetrahydronaphthalen-1-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135018497 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (NE)-N-(6,7-dimethyl-4-oxo-4a,5,8,8a-tetrahydronaphthalen-1-ylidene)-4-methylbenzenesulfonamide |
| SMILES | CC1=C(C)CC2/C(=N/S(=O)(=O)c3ccc(C)cc3)C=CC(=O)C2C1 |
| InChI | InChI=1S/C19H21NO3S/c1-12-4-6-15(7-5-12)24(22,23)20-18-8-9-19(21)17-11-14(3)13(2)10-16(17)18/h4-9,16-17H,10-11H2,1-3H3/b20-18+ |
| InChIKey | OQMAVMGAAJKSNV-CZIZESTLSA-N |
| XLogP | 3.63 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|