C12H14N2O2S2 — CID 3719225
N-(3,4-dimethyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 3719225) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3719225 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-(3,4-dimethyl-1,3-thiazol-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=c2scc(C)n2C)cc1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-9-4-6-11(7-5-9)18(15,16)13-12-14(3)10(2)8-17-12/h4-8H,1-3H3 |
| InChIKey | HBZOSKXGMCNOTE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|