C30H28N2O4S2 — CID 100712092
4-methyl-N-[(1R,2R,11R,12R)-10-(4-methylphenyl)sulfonylimino-3-tetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraenylidene]benzenesulfonamide (PubChem CID 100712092) has the molecular formula C30H28N2O4S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R,11R,12R)-10-(4-methylphenyl)sulfonylimino-3-tetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraenylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R,11R,12R)-10-(4-methylphenyl)sulfonylimino-3-tetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraenylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 100712092 |
| Molecular Formula | C30H28N2O4S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 4-methyl-N-[(1R,2R,11R,12R)-10-(4-methylphenyl)sulfonylimino-3-tetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraenylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2c3ccccc3C(=NS(=O)(=O)c3ccc(C)cc3)[C@H]3[C@H]2[C@H]2C=C[C@H]3CC2)cc1 |
| InChI | InChI=1S/C30H28N2O4S2/c1-19-7-15-23(16-8-19)37(33,34)31-29-25-5-3-4-6-26(25)30(28-22-13-11-21(12-14-22)27(28)29)32-38(35,36)24-17-9-20(2)10-18-24/h3-11,13,15-18,21-22,27-28H,12,14H2,1-2H3/t21-,22-,27+,28+/m0/s1 |
| InChIKey | ABMLLTLNGNNSOI-SHRQFBHGSA-N |
| XLogP | 5.50 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|