C17H18N2O2S — CID 134907065
(NZ)-N-(1,3-dimethyl-3H-indol-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 134907065) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is (NZ)-N-(1,3-dimethyl-3H-indol-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-(1,3-dimethyl-3H-indol-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134907065 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (NZ)-N-(1,3-dimethyl-3H-indol-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/C(C)c3ccccc3N2C)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-12-8-10-14(11-9-12)22(20,21)18-17-13(2)15-6-4-5-7-16(15)19(17)3/h4-11,13H,1-3H3/b18-17- |
| InChIKey | PVIKNPZPYZMGOV-ZCXUNETKSA-N |
| XLogP | 3.34 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|