C22H27N3O2S — CID 177384999
(NZ)-4-methyl-N-(3-phenyl-1-propan-2-yl-4-propan-2-yliminoazetidin-2-ylidene)benzenesulfonamide (PubChem CID 177384999) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is (NZ)-4-methyl-N-(3-phenyl-1-propan-2-yl-4-propan-2-yliminoazetidin-2-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-4-methyl-N-(3-phenyl-1-propan-2-yl-4-propan-2-yliminoazetidin-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 177384999 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (NZ)-4-methyl-N-(3-phenyl-1-propan-2-yl-4-propan-2-yliminoazetidin-2-ylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/C(c3ccccc3)/C(=N/C(C)C)N2C(C)C)cc1 |
| InChI | InChI=1S/C22H27N3O2S/c1-15(2)23-21-20(18-9-7-6-8-10-18)22(25(21)16(3)4)24-28(26,27)19-13-11-17(5)12-14-19/h6-16,20H,1-5H3/b23-21-,24-22- |
| InChIKey | WKDSSXXWUFCDLD-SXAUZNKPSA-N |
| XLogP | 4.40 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|