C30H26N2O4S2 — CID 57338971
4-methyl-N-[(3E)-3-(4-methylphenyl)sulfonylimino-2,4-diphenylcyclobuten-1-yl]benzenesulfonimidic acid (PubChem CID 57338971) has the molecular formula C30H26N2O4S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 4-methyl-N-[(3E)-3-(4-methylphenyl)sulfonylimino-2,4-diphenylcyclobuten-1-yl]benzenesulfonimidic acid.
| Compound Name | 4-methyl-N-[(3E)-3-(4-methylphenyl)sulfonylimino-2,4-diphenylcyclobuten-1-yl]benzenesulfonimidic acid |
|---|---|
| PubChem CID | 57338971 |
| Molecular Formula | C30H26N2O4S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 4-methyl-N-[(3E)-3-(4-methylphenyl)sulfonylimino-2,4-diphenylcyclobuten-1-yl]benzenesulfonimidic acid |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/C(c3ccccc3)=C(N=S(=O)(O)c3ccc(C)cc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N2O4S2/c1-21-13-17-25(18-14-21)37(33,34)31-29-27(23-9-5-3-6-10-23)30(28(29)24-11-7-4-8-12-24)32-38(35,36)26-19-15-22(2)16-20-26/h3-20,27H,1-2H3,(H,31,33,34)/b32-30+ |
| InChIKey | CVGZPXKVXLLXPP-NHQGMKOOSA-N |
| XLogP | 6.64 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|