C30H25N3O3S — CID 10505796
(NE)-4-methyl-N-[1-(4-methylphenyl)-6-oxo-4,5-diphenyl-5H-pyrimidin-2-ylidene]benzenesulfonamide (PubChem CID 10505796) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is (NE)-4-methyl-N-[1-(4-methylphenyl)-6-oxo-4,5-diphenyl-5H-pyrimidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[1-(4-methylphenyl)-6-oxo-4,5-diphenyl-5H-pyrimidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 10505796 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (NE)-4-methyl-N-[1-(4-methylphenyl)-6-oxo-4,5-diphenyl-5H-pyrimidin-2-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)C(c3ccccc3)C(c3ccccc3)=N/C2=N\S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H25N3O3S/c1-21-13-17-25(18-14-21)33-29(34)27(23-9-5-3-6-10-23)28(24-11-7-4-8-12-24)31-30(33)32-37(35,36)26-19-15-22(2)16-20-26/h3-20,27H,1-2H3/b32-30+ |
| InChIKey | WXVIVRZXBXLHKZ-NHQGMKOOSA-N |
| XLogP | 5.67 |
| TPSA | 79.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|