C21H17N3O2S2 — CID 12686867
(NZ)-N-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-4-methylbenzenesulfonamide (PubChem CID 12686867) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (NZ)-N-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12686867 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (NZ)-N-(2,3-diphenyl-1,2,4-thiadiazol-5-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=c2/nc(-c3ccccc3)n(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C21H17N3O2S2/c1-16-12-14-19(15-13-16)28(25,26)23-21-22-20(17-8-4-2-5-9-17)24(27-21)18-10-6-3-7-11-18/h2-15H,1H3/b23-21- |
| InChIKey | WQGBLHRJCQIZCY-LNVKXUELSA-N |
| XLogP | 4.20 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|