C21H17N3O2S — CID 86233643
1-(4-methylphenyl)sulfonyl-3,5-diphenyl-1,2,4-triazole (PubChem CID 86233643) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 86233643 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,5-diphenyl-1,2,4-triazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nc(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3O2S/c1-16-12-14-19(15-13-16)27(25,26)24-21(18-10-6-3-7-11-18)22-20(23-24)17-8-4-2-5-9-17/h2-15H,1H3 |
| InChIKey | PIQKQJBWSWUDGY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |