C16H16N4O2S — CID 828557
5-(4-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,2,4-triazol-3-amine (PubChem CID 828557) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 828557 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-(4-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,2,4-triazol-3-amine |
| SMILES | Cc1ccc(-c2nc(N)n(S(=O)(=O)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11-3-7-13(8-4-11)15-18-16(17)20(19-15)23(21,22)14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,17,18,19) |
| InChIKey | DBSJGLVLQFRHSP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |