C25H24N2O2S — CID 19588047
4-methyl-3,5-bis(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrazole (PubChem CID 19588047) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-methyl-3,5-bis(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrazole.
| Compound Name | 4-methyl-3,5-bis(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 19588047 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-methyl-3,5-bis(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrazole |
| SMILES | Cc1ccc(-c2nn(S(=O)(=O)c3ccc(C)cc3)c(-c3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-17-5-11-21(12-6-17)24-20(4)25(22-13-7-18(2)8-14-22)27(26-24)30(28,29)23-15-9-19(3)10-16-23/h5-16H,1-4H3 |
| InChIKey | UDYOLNKXWVOWER-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |