C22H20N2O4S3 — CID 156769792
3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-thiophen-3-ylpyrazole (PubChem CID 156769792) has the molecular formula C22H20N2O4S3 and a molecular weight of 472.61 g/mol. Its IUPAC name is 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-thiophen-3-ylpyrazole.
| Compound Name | 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-thiophen-3-ylpyrazole |
|---|---|
| PubChem CID | 156769792 |
| Molecular Formula | C22H20N2O4S3 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-thiophen-3-ylpyrazole |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(S(=O)(=O)c3ccc(C)cc3)c2-c2ccsc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S3/c1-15-4-8-19(9-5-15)30(25,26)22-17(3)23-24(21(22)18-12-13-29-14-18)31(27,28)20-10-6-16(2)7-11-20/h4-14H,1-3H3 |
| InChIKey | WACMTPMDVLJWRB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |