C26H22N2O4S3 — CID 156769790
5-(1-benzothiophen-2-yl)-3-methyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole (PubChem CID 156769790) has the molecular formula C26H22N2O4S3 and a molecular weight of 522.67 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)-3-methyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole.
| Compound Name | 5-(1-benzothiophen-2-yl)-3-methyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 156769790 |
| Molecular Formula | C26H22N2O4S3 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)-3-methyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(S(=O)(=O)c3ccc(C)cc3)c2-c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C26H22N2O4S3/c1-17-8-12-21(13-9-17)34(29,30)26-19(3)27-28(35(31,32)22-14-10-18(2)11-15-22)25(26)24-16-20-6-4-5-7-23(20)33-24/h4-16H,1-3H3 |
| InChIKey | KOMVWTHTUANFKK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |