C22H16F2N2O4S2 — CID 163303734
1,4-bis[(4-fluorophenyl)sulfonyl]-3-methyl-5-phenylpyrazole (PubChem CID 163303734) has the molecular formula C22H16F2N2O4S2 and a molecular weight of 474.51 g/mol. Its IUPAC name is 1,4-bis[(4-fluorophenyl)sulfonyl]-3-methyl-5-phenylpyrazole.
| Compound Name | 1,4-bis[(4-fluorophenyl)sulfonyl]-3-methyl-5-phenylpyrazole |
|---|---|
| PubChem CID | 163303734 |
| Molecular Formula | C22H16F2N2O4S2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 1,4-bis[(4-fluorophenyl)sulfonyl]-3-methyl-5-phenylpyrazole |
| SMILES | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(-c2ccccc2)c1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16F2N2O4S2/c1-15-22(31(27,28)19-11-7-17(23)8-12-19)21(16-5-3-2-4-6-16)26(25-15)32(29,30)20-13-9-18(24)10-14-20/h2-14H,1H3 |
| InChIKey | HHVGZCCXEOBPPA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |