C16H15NO2S2 — CID 166448666
N-(1-benzothiophen-2-yl)-N,4-dimethylbenzenesulfonamide (PubChem CID 166448666) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-(1-benzothiophen-2-yl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(1-benzothiophen-2-yl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166448666 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(1-benzothiophen-2-yl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H15NO2S2/c1-12-7-9-14(10-8-12)21(18,19)17(2)16-11-13-5-3-4-6-15(13)20-16/h3-11H,1-2H3 |
| InChIKey | TWAPUFVJKHMPKN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |