C11H13NS — CID 166120724
N,N,5-trimethyl-1-benzothiophen-2-amine (PubChem CID 166120724) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is N,N,5-trimethyl-1-benzothiophen-2-amine.
| Compound Name | N,N,5-trimethyl-1-benzothiophen-2-amine |
|---|---|
| PubChem CID | 166120724 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | N,N,5-trimethyl-1-benzothiophen-2-amine |
| SMILES | Cc1ccc2sc(N(C)C)cc2c1 |
| InChI | InChI=1S/C11H13NS/c1-8-4-5-10-9(6-8)7-11(13-10)12(2)3/h4-7H,1-3H3 |
| InChIKey | FFUGKHGLOGMMGW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |