C17H15NO5S2 — CID 167570192
N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 167570192) has the molecular formula C17H15NO5S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 167570192 |
| Molecular Formula | C17H15NO5S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | C=C(O)c1cc2sc(N(C)S(=O)(=O)c3ccc(C)cc3)cc2oc1=O |
| InChI | InChI=1S/C17H15NO5S2/c1-10-4-6-12(7-5-10)25(21,22)18(3)16-9-14-15(24-16)8-13(11(2)19)17(20)23-14/h4-9,19H,2H2,1,3H3 |
| InChIKey | JXNZYACDEDVPOB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|