About N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide
N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 167570192) has the molecular formula C17H15NO5S2
and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide |
| PubChem CID | 167570192 |
| Molecular Formula | C17H15NO5S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | C=C(O)c1cc2sc(N(C)S(=O)(=O)c3ccc(C)cc3)cc2oc1=O |
| InChI | InChI=1S/C17H15NO5S2/c1-10-4-6-12(7-5-10)25(21,22)18(3)16-9-14-15(24-16)8-13(11(2)19)17(20)23-14/h4-9,19H,2H2,1,3H3 |
| InChIKey | JXNZYACDEDVPOB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide?
The IUPAC name of N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide (CID 167570192) is N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide.
What is the SMILES notation for N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide?
The canonical SMILES for N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide is C=C(O)c1cc2sc(N(C)S(=O)(=O)c3ccc(C)cc3)cc2oc1=O.
What is the InChIKey of N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide?
The InChIKey is JXNZYACDEDVPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5S2/c1-10-4-6-12(7-5-10)25(21,22)18(3)16-9-14-15(24-16)8-13(11(2)19)17(20)23-14/h4-9,19H,2H2,1,3H3.
What are the key properties of N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide?
N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide has a molecular weight of 377.44 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,4-dimethylbenzenesulfonamide is sourced from PubChem (CID 167570192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).