C18H15NO4S — CID 167586068
N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,3-dimethylbenzamide (PubChem CID 167586068) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,3-dimethylbenzamide.
| Compound Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 167586068 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-N,3-dimethylbenzamide |
| SMILES | C=C(O)c1cc2sc(N(C)C(=O)c3cccc(C)c3)cc2oc1=O |
| InChI | InChI=1S/C18H15NO4S/c1-10-5-4-6-12(7-10)17(21)19(3)16-9-14-15(24-16)8-13(11(2)20)18(22)23-14/h4-9,20H,2H2,1,3H3 |
| InChIKey | BKIXOBDKTRPQHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|