About methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate
methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate (PubChem CID 164521212) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate |
| PubChem CID | 164521212 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate |
| SMILES | COC(=O)c1cc2sc(N(C)C(=O)NC3CCCC3)cc2oc1=O |
| InChI | InChI=1S/C16H18N2O5S/c1-18(16(21)17-9-5-3-4-6-9)13-8-11-12(24-13)7-10(14(19)22-2)15(20)23-11/h7-9H,3-6H2,1-2H3,(H,17,21) |
| InChIKey | REAYGYDKZSQYIB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate?
The IUPAC name of methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate (CID 164521212) is methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate.
What is the SMILES notation for methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate?
The canonical SMILES for methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate is COC(=O)c1cc2sc(N(C)C(=O)NC3CCCC3)cc2oc1=O.
What is the InChIKey of methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate?
The InChIKey is REAYGYDKZSQYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c1-18(16(21)17-9-5-3-4-6-9)13-8-11-12(24-13)7-10(14(19)22-2)15(20)23-11/h7-9H,3-6H2,1-2H3,(H,17,21).
What are the key properties of methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate?
methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate has a molecular weight of 350.40 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[cyclopentylcarbamoyl(methyl)amino]-5-oxothieno[3,2-b]pyran-6-carboxylate is sourced from PubChem (CID 164521212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).