C21H20N2O4S — CID 167624666
1-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-1-methyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 167624666) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-1-methyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-1-methyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 167624666 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[6-(1-hydroxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-1-methyl-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | C=C(O)c1cc2sc(N(C)C(=O)Nc3cccc4c3CCCC4)cc2oc1=O |
| InChI | InChI=1S/C21H20N2O4S/c1-12(24)15-10-18-17(27-20(15)25)11-19(28-18)23(2)21(26)22-16-9-5-7-13-6-3-4-8-14(13)16/h5,7,9-11,24H,1,3-4,6,8H2,2H3,(H,22,26) |
| InChIKey | LLWXRFFCUTXTDZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|