C24H30N2O5 — CID 10025485
N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methoxy-2-oxochromene-3-carboxamide (PubChem CID 10025485) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 10025485 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)N(C(=O)NC3CCCCC3)C3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H30N2O5/c1-30-19-13-12-16-14-20(23(28)31-21(16)15-19)22(27)26(18-10-6-3-7-11-18)24(29)25-17-8-4-2-5-9-17/h12-15,17-18H,2-11H2,1H3,(H,25,29) |
| InChIKey | QGDJTRAVZRDVHK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|