C34H43N3O8 — CID 102259131
dimethyl 2-(cyclohexylamino)-5-[cyclohexyl-[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]furan-3,4-dicarboxylate (PubChem CID 102259131) has the molecular formula C34H43N3O8 and a molecular weight of 621.73 g/mol. Its IUPAC name is dimethyl 2-(cyclohexylamino)-5-[cyclohexyl-[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(cyclohexylamino)-5-[cyclohexyl-[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102259131 |
| Molecular Formula | C34H43N3O8 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | dimethyl 2-(cyclohexylamino)-5-[cyclohexyl-[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]furan-3,4-dicarboxylate |
| SMILES | CCN(CC)c1ccc2cc(C(=O)N(c3oc(NC4CCCCC4)c(C(=O)OC)c3C(=O)OC)C3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C34H43N3O8/c1-5-36(6-2)24-18-17-21-19-25(32(39)44-26(21)20-24)30(38)37(23-15-11-8-12-16-23)31-28(34(41)43-4)27(33(40)42-3)29(45-31)35-22-13-9-7-10-14-22/h17-20,22-23,35H,5-16H2,1-4H3 |
| InChIKey | SMOVQULIGJGILB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|