C22H21F3N2O3 — CID 3231416
7-(diethylamino)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]chromene-3-carboxamide (PubChem CID 3231416) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 7-(diethylamino)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]chromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 3231416 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 7-(diethylamino)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCc3ccc(C(F)(F)F)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-3-27(4-2)17-10-7-15-11-18(21(29)30-19(15)12-17)20(28)26-13-14-5-8-16(9-6-14)22(23,24)25/h5-12H,3-4,13H2,1-2H3,(H,26,28) |
| InChIKey | KNBXXMNZOOAGCU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|