C33H41F3N2O4 — CID 162539974
7-(diethylamino)-2-oxo-N-[(4Z,7Z,10Z,13Z)-19,19,19-trifluoro-18-oxononadeca-4,7,10,13-tetraenyl]chromene-3-carboxamide (PubChem CID 162539974) has the molecular formula C33H41F3N2O4 and a molecular weight of 586.70 g/mol. Its IUPAC name is 7-(diethylamino)-2-oxo-N-[(4Z,7Z,10Z,13Z)-19,19,19-trifluoro-18-oxononadeca-4,7,10,13-tetraenyl]chromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-2-oxo-N-[(4Z,7Z,10Z,13Z)-19,19,19-trifluoro-18-oxononadeca-4,7,10,13-tetraenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 162539974 |
| Molecular Formula | C33H41F3N2O4 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 7-(diethylamino)-2-oxo-N-[(4Z,7Z,10Z,13Z)-19,19,19-trifluoro-18-oxononadeca-4,7,10,13-tetraenyl]chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C33H41F3N2O4/c1-3-38(4-2)27-22-21-26-24-28(32(41)42-29(26)25-27)31(40)37-23-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-30(39)33(34,35)36/h6-9,12-15,21-22,24-25H,3-5,10-11,16-20,23H2,1-2H3,(H,37,40)/b8-6-,9-7-,14-12-,15-13- |
| InChIKey | PGMSAFQSUPDRJQ-YEMTZORJSA-N |
| XLogP | 7.85 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|