C25H37N3O3 — CID 123776814
N-(5-amino-7,7-dimethyl-6-methylideneoctyl)-7-(diethylamino)-2-oxochromene-3-carboxamide (PubChem CID 123776814) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-(5-amino-7,7-dimethyl-6-methylideneoctyl)-7-(diethylamino)-2-oxochromene-3-carboxamide.
| Compound Name | N-(5-amino-7,7-dimethyl-6-methylideneoctyl)-7-(diethylamino)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 123776814 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | N-(5-amino-7,7-dimethyl-6-methylideneoctyl)-7-(diethylamino)-2-oxochromene-3-carboxamide |
| SMILES | C=C(C(N)CCCCNC(=O)c1cc2ccc(N(CC)CC)cc2oc1=O)C(C)(C)C |
| InChI | InChI=1S/C25H37N3O3/c1-7-28(8-2)19-13-12-18-15-20(24(30)31-22(18)16-19)23(29)27-14-10-9-11-21(26)17(3)25(4,5)6/h12-13,15-16,21H,3,7-11,14,26H2,1-2,4-6H3,(H,27,29) |
| InChIKey | MBEQHWFLOMBFLB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|