C42H51N5O7 — CID 160804475
9H-fluoren-9-ylmethyl N-[(5S,8R)-1-amino-8-carbamoyl-12-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-6-oxododecan-5-yl]carbamate (PubChem CID 160804475) has the molecular formula C42H51N5O7 and a molecular weight of 737.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(5S,8R)-1-amino-8-carbamoyl-12-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-6-oxododecan-5-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(5S,8R)-1-amino-8-carbamoyl-12-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-6-oxododecan-5-yl]carbamate |
|---|---|
| PubChem CID | 160804475 |
| Molecular Formula | C42H51N5O7 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.38 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(5S,8R)-1-amino-8-carbamoyl-12-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]-6-oxododecan-5-yl]carbamate |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCCCC[C@H](CC(=O)[C@H](CCCCN)NC(=O)OCC3c4ccccc4-c4ccccc43)C(N)=O)c(=O)oc2c1 |
| InChI | InChI=1S/C42H51N5O7/c1-3-47(4-2)29-20-19-27-23-34(41(51)54-38(27)25-29)40(50)45-22-12-10-13-28(39(44)49)24-37(48)36(18-9-11-21-43)46-42(52)53-26-35-32-16-7-5-14-30(32)31-15-6-8-17-33(31)35/h5-8,14-17,19-20,23,25,28,35-36H,3-4,9-13,18,21-22,24,26,43H2,1-2H3,(H2,44,49)(H,45,50)(H,46,52)/t28-,36+/m1/s1 |
| InChIKey | ASKWQSGVRDROAZ-OCKRADGESA-N |
| XLogP | 5.64 |
| TPSA | 187.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|