C41H46N4O9 — CID 58473748
prop-2-enyl 6-amino-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoyl]amino]hexanoate (PubChem CID 58473748) has the molecular formula C41H46N4O9 and a molecular weight of 738.84 g/mol. Its IUPAC name is prop-2-enyl 6-amino-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoyl]amino]hexanoate.
| Compound Name | prop-2-enyl 6-amino-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 58473748 |
| Molecular Formula | C41H46N4O9 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 738.33 |
| IUPAC Name | prop-2-enyl 6-amino-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(7-methoxy-2-oxochromene-3-carbonyl)amino]hexanoyl]amino]hexanoate |
| SMILES | C=CCOC(=O)C(CCCCN)NC(=O)C(CCCCNC(=O)c1cc2ccc(OC)cc2oc1=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H46N4O9/c1-3-22-52-40(49)35(17-8-10-20-42)44-38(47)34(45-41(50)53-25-33-30-14-6-4-12-28(30)29-13-5-7-15-31(29)33)16-9-11-21-43-37(46)32-23-26-18-19-27(51-2)24-36(26)54-39(32)48/h3-7,12-15,18-19,23-24,33-35H,1,8-11,16-17,20-22,25,42H2,2H3,(H,43,46)(H,44,47)(H,45,50) |
| InChIKey | WQGZUTLNZCERDF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|