C22H30N2O6 — CID 146955476
[3-(2,2-dimethylpropanoyloxy)propylamino] 7-(diethylamino)-2-oxochromene-3-carboxylate (PubChem CID 146955476) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoyloxy)propylamino] 7-(diethylamino)-2-oxochromene-3-carboxylate.
| Compound Name | [3-(2,2-dimethylpropanoyloxy)propylamino] 7-(diethylamino)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 146955476 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [3-(2,2-dimethylpropanoyloxy)propylamino] 7-(diethylamino)-2-oxochromene-3-carboxylate |
| SMILES | CCN(CC)c1ccc2cc(C(=O)ONCCCOC(=O)C(C)(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C22H30N2O6/c1-6-24(7-2)16-10-9-15-13-17(19(25)29-18(15)14-16)20(26)30-23-11-8-12-28-21(27)22(3,4)5/h9-10,13-14,23H,6-8,11-12H2,1-5H3 |
| InChIKey | AJNWMYYDFNBSQI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|