C27H36N2O12 — CID 87184011
3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]propoxy]propanoic acid (PubChem CID 87184011) has the molecular formula C27H36N2O12 and a molecular weight of 580.59 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 87184011 |
| Molecular Formula | C27H36N2O12 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[7-(diethylamino)-2-oxochromene-3-carbonyl]amino]propoxy]propanoic acid |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C27H36N2O12/c1-3-29(4-2)19-6-5-18-13-20(26(37)41-21(18)14-19)25(36)28-27(15-38-10-7-22(30)31,16-39-11-8-23(32)33)17-40-12-9-24(34)35/h5-6,13-14H,3-4,7-12,15-17H2,1-2H3,(H,28,36)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | FBUZXDHCIUTFGP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 202.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|