C17H20N2O5 — CID 3243384
4-[[7-(diethylamino)-2-oxochromen-3-yl]amino]-4-oxobutanoic acid (PubChem CID 3243384) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[[7-(diethylamino)-2-oxochromen-3-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[7-(diethylamino)-2-oxochromen-3-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3243384 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-[[7-(diethylamino)-2-oxochromen-3-yl]amino]-4-oxobutanoic acid |
| SMILES | CCN(CC)c1ccc2cc(NC(=O)CCC(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C17H20N2O5/c1-3-19(4-2)12-6-5-11-9-13(17(23)24-14(11)10-12)18-15(20)7-8-16(21)22/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | SMSLFSMAYOUFSR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|