C20H21CuN3O3 — CID 159081950
copper;7-(diethylamino)-2-oxo-N-(pyridin-2-ylmethyl)chromene-3-carboxamide (PubChem CID 159081950) has the molecular formula C20H21CuN3O3 and a molecular weight of 414.95 g/mol. Its IUPAC name is copper;7-(diethylamino)-2-oxo-N-(pyridin-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | copper;7-(diethylamino)-2-oxo-N-(pyridin-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 159081950 |
| Molecular Formula | C20H21CuN3O3 |
| Molecular Weight | 414.95 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | copper;7-(diethylamino)-2-oxo-N-(pyridin-2-ylmethyl)chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)NCc3ccccn3)c(=O)oc2c1.[Cu] |
| InChI | InChI=1S/C20H21N3O3.Cu/c1-3-23(4-2)16-9-8-14-11-17(20(25)26-18(14)12-16)19(24)22-13-15-7-5-6-10-21-15;/h5-12H,3-4,13H2,1-2H3,(H,22,24); |
| InChIKey | KAYVCVJLJFJNBI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|