C23H17NO4S — CID 156714159
N-[6-(1-methoxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-3-phenylbenzamide (PubChem CID 156714159) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[6-(1-methoxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-3-phenylbenzamide.
| Compound Name | N-[6-(1-methoxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 156714159 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[6-(1-methoxyethenyl)-5-oxothieno[3,2-b]pyran-2-yl]-3-phenylbenzamide |
| SMILES | C=C(OC)c1cc2sc(NC(=O)c3cccc(-c4ccccc4)c3)cc2oc1=O |
| InChI | InChI=1S/C23H17NO4S/c1-14(27-2)18-12-20-19(28-23(18)26)13-21(29-20)24-22(25)17-10-6-9-16(11-17)15-7-4-3-5-8-15/h3-13H,1H2,2H3,(H,24,25) |
| InChIKey | CYOIIDRCRVNHNP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|