C9H5BrO4S — CID 139550435
methyl 2-bromo-5-oxothieno[3,2-b]pyran-6-carboxylate (PubChem CID 139550435) has the molecular formula C9H5BrO4S and a molecular weight of 289.11 g/mol. Its IUPAC name is methyl 2-bromo-5-oxothieno[3,2-b]pyran-6-carboxylate.
| Compound Name | methyl 2-bromo-5-oxothieno[3,2-b]pyran-6-carboxylate |
|---|---|
| PubChem CID | 139550435 |
| Molecular Formula | C9H5BrO4S |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | methyl 2-bromo-5-oxothieno[3,2-b]pyran-6-carboxylate |
| SMILES | COC(=O)c1cc2sc(Br)cc2oc1=O |
| InChI | InChI=1S/C9H5BrO4S/c1-13-8(11)4-2-6-5(14-9(4)12)3-7(10)15-6/h2-3H,1H3 |
| InChIKey | OFEYLAKCUYFQGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |