methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate

C14H10O4S — CID 12641050

IUPACmethyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate
SMILESCOC(=O)c1cc2ccc3sc(C)cc3c2oc1=O
InChIInChI=1S/C14H10O4S/c1-7-5-9-11(19-7)4-3-8-6-10(13(15)17-2)14(16)18-12(8)9/h3-6H,1-2H3
InChIKeyUMBGEUPAGAMGLV-UHFFFAOYSA-N
MW274.30 g/mol
LogP3.10
Rot. Bonds1

About methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate

methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate (PubChem CID 12641050) has the molecular formula C14H10O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate.

Molecular Properties

Compound Namemethyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate
PubChem CID12641050
Molecular FormulaC14H10O4S
Molecular Weight274.30 g/mol
Exact Mass274.03
IUPAC Namemethyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate
SMILESCOC(=O)c1cc2ccc3sc(C)cc3c2oc1=O
InChIInChI=1S/C14H10O4S/c1-7-5-9-11(19-7)4-3-8-6-10(13(15)17-2)14(16)18-12(8)9/h3-6H,1-2H3
InChIKeyUMBGEUPAGAMGLV-UHFFFAOYSA-N
XLogP3.10
TPSA56.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.30
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate?
The IUPAC name of methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate (CID 12641050) is methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate.
What is the SMILES notation for methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate?
The canonical SMILES for methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate is COC(=O)c1cc2ccc3sc(C)cc3c2oc1=O.
What is the InChIKey of methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate?
The InChIKey is UMBGEUPAGAMGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4S/c1-7-5-9-11(19-7)4-3-8-6-10(13(15)17-2)14(16)18-12(8)9/h3-6H,1-2H3.
What are the key properties of methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate?
methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate has a molecular weight of 274.30 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate is sourced from PubChem (CID 12641050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).