C14H10O4S — CID 12641050
methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate (PubChem CID 12641050) has the molecular formula C14H10O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate.
| Compound Name | methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate |
|---|---|
| PubChem CID | 12641050 |
| Molecular Formula | C14H10O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl 8-methyl-2-oxothieno[2,3-h]chromene-3-carboxylate |
| SMILES | COC(=O)c1cc2ccc3sc(C)cc3c2oc1=O |
| InChI | InChI=1S/C14H10O4S/c1-7-5-9-11(19-7)4-3-8-6-10(13(15)17-2)14(16)18-12(8)9/h3-6H,1-2H3 |
| InChIKey | UMBGEUPAGAMGLV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|