C19H19NO6 — CID 44582525
diethyl 8,9-dimethyl-2-oxopyrano[2,3-e]isoindole-3,7-dicarboxylate (PubChem CID 44582525) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is diethyl 8,9-dimethyl-2-oxopyrano[2,3-e]isoindole-3,7-dicarboxylate.
| Compound Name | diethyl 8,9-dimethyl-2-oxopyrano[2,3-e]isoindole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 44582525 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | diethyl 8,9-dimethyl-2-oxopyrano[2,3-e]isoindole-3,7-dicarboxylate |
| SMILES | CCOC(=O)c1cc2ccc3c(C(=O)OCC)n(C)c(C)c3c2oc1=O |
| InChI | InChI=1S/C19H19NO6/c1-5-24-17(21)13-9-11-7-8-12-14(16(11)26-18(13)22)10(3)20(4)15(12)19(23)25-6-2/h7-9H,5-6H2,1-4H3 |
| InChIKey | XXJOBPSRXKWGPY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|