C15H11NO6 — CID 10685671
ethyl 7-hydroxy-2,3-dioxo-10H-pyrano[3,2-h]quinoline-8-carboxylate (PubChem CID 10685671) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is ethyl 7-hydroxy-2,3-dioxo-10H-pyrano[3,2-h]quinoline-8-carboxylate.
| Compound Name | ethyl 7-hydroxy-2,3-dioxo-10H-pyrano[3,2-h]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 10685671 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 7-hydroxy-2,3-dioxo-10H-pyrano[3,2-h]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(ccc3cc(=O)c(=O)oc32)c1O |
| InChI | InChI=1S/C15H11NO6/c1-2-21-14(19)9-6-16-11-8(12(9)18)4-3-7-5-10(17)15(20)22-13(7)11/h3-6,16,18H,2H2,1H3 |
| InChIKey | HJAPCOQDMFTYHK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|