C33H40O13 — CID 158548506
ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate;ethyl 2-oxo-7,8-dipropoxychromene-3-carboxylate;propan-1-ol (PubChem CID 158548506) has the molecular formula C33H40O13 and a molecular weight of 644.67 g/mol. Its IUPAC name is ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate;ethyl 2-oxo-7,8-dipropoxychromene-3-carboxylate;propan-1-ol.
| Compound Name | ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate;ethyl 2-oxo-7,8-dipropoxychromene-3-carboxylate;propan-1-ol |
|---|---|
| PubChem CID | 158548506 |
| Molecular Formula | C33H40O13 |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate;ethyl 2-oxo-7,8-dipropoxychromene-3-carboxylate;propan-1-ol |
| SMILES | CCCO.CCCOc1ccc2cc(C(=O)OCC)c(=O)oc2c1OCCC.CCOC(=O)c1cc2ccc(O)c(O)c2oc1=O |
| InChI | InChI=1S/C18H22O6.C12H10O6.C3H8O/c1-4-9-22-14-8-7-12-11-13(17(19)21-6-3)18(20)24-15(12)16(14)23-10-5-2;1-2-17-11(15)7-5-6-3-4-8(13)9(14)10(6)18-12(7)16;1-2-3-4/h7-8,11H,4-6,9-10H2,1-3H3;3-5,13-14H,2H2,1H3;4H,2-3H2,1H3 |
| InChIKey | HPKSYRSVLXDRLY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 192.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|