C30H26N2O4S — CID 135068633
(NE)-N-[3-(4-methoxyphenyl)-4,6-diphenyl-4H-1,3-oxazin-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 135068633) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is (NE)-N-[3-(4-methoxyphenyl)-4,6-diphenyl-4H-1,3-oxazin-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[3-(4-methoxyphenyl)-4,6-diphenyl-4H-1,3-oxazin-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135068633 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (NE)-N-[3-(4-methoxyphenyl)-4,6-diphenyl-4H-1,3-oxazin-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2/C(=N\S(=O)(=O)c3ccc(C)cc3)OC(c3ccccc3)=CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N2O4S/c1-22-13-19-27(20-14-22)37(33,34)31-30-32(25-15-17-26(35-2)18-16-25)28(23-9-5-3-6-10-23)21-29(36-30)24-11-7-4-8-12-24/h3-21,28H,1-2H3/b31-30+ |
| InChIKey | XCBPLAJPBRXENW-NVQSTNCTSA-N |
| XLogP | 6.37 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|