C32H31NO2 — CID 90120132
2,5-bis(4-methoxyphenyl)-1,3-bis(4-methylphenyl)-2,3-dihydropyrrole (PubChem CID 90120132) has the molecular formula C32H31NO2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-1,3-bis(4-methylphenyl)-2,3-dihydropyrrole.
| Compound Name | 2,5-bis(4-methoxyphenyl)-1,3-bis(4-methylphenyl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 90120132 |
| Molecular Formula | C32H31NO2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-1,3-bis(4-methylphenyl)-2,3-dihydropyrrole |
| SMILES | COc1ccc(C2=CC(c3ccc(C)cc3)C(c3ccc(OC)cc3)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H31NO2/c1-22-5-9-24(10-6-22)30-21-31(25-11-17-28(34-3)18-12-25)33(27-15-7-23(2)8-16-27)32(30)26-13-19-29(35-4)20-14-26/h5-21,30,32H,1-4H3 |
| InChIKey | OJDQYVFWZIFKSB-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |