C23H22N2O4S — CID 10477333
3-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-6-phenyl-6H-oxadiazine (PubChem CID 10477333) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-6-phenyl-6H-oxadiazine.
| Compound Name | 3-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-6-phenyl-6H-oxadiazine |
|---|---|
| PubChem CID | 10477333 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-6-phenyl-6H-oxadiazine |
| SMILES | COc1ccc(N2C=CC(c3ccccc3)ON2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c1-18-8-14-22(15-9-18)30(26,27)25-24(20-10-12-21(28-2)13-11-20)17-16-23(29-25)19-6-4-3-5-7-19/h3-17,23H,1-2H3 |
| InChIKey | NHHMNMKIDIUTTH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |