C23H24N2O4S2 — CID 101382712
N-[[2-(4-methoxyphenyl)aziridin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 101382712) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[[2-(4-methoxyphenyl)aziridin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[2-(4-methoxyphenyl)aziridin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101382712 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[[2-(4-methoxyphenyl)aziridin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C2CN2S(=O)(=NS(=O)(=O)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-17-4-12-21(13-5-17)30(26,24-31(27,28)22-14-6-18(2)7-15-22)25-16-23(25)19-8-10-20(29-3)11-9-19/h4-15,23H,16H2,1-3H3 |
| InChIKey | IBVLOMHNTBEYHB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|