C30H20F6N2O4S2 — CID 57339042
N-[(3E)-2,4-diphenyl-3-[4-(trifluoromethyl)phenyl]sulfonyliminocyclobuten-1-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 57339042) has the molecular formula C30H20F6N2O4S2 and a molecular weight of 650.62 g/mol. Its IUPAC name is N-[(3E)-2,4-diphenyl-3-[4-(trifluoromethyl)phenyl]sulfonyliminocyclobuten-1-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3E)-2,4-diphenyl-3-[4-(trifluoromethyl)phenyl]sulfonyliminocyclobuten-1-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57339042 |
| Molecular Formula | C30H20F6N2O4S2 |
| Molecular Weight | 650.62 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | N-[(3E)-2,4-diphenyl-3-[4-(trifluoromethyl)phenyl]sulfonyliminocyclobuten-1-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(/N=C1/C(c2ccccc2)=C(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H20F6N2O4S2/c31-29(32,33)21-11-15-23(16-12-21)43(39,40)37-27-25(19-7-3-1-4-8-19)28(26(27)20-9-5-2-6-10-20)38-44(41,42)24-17-13-22(14-18-24)30(34,35)36/h1-18,25,37H/b38-28+ |
| InChIKey | PYUWUCDPTPAMNI-HXPUERGNSA-N |
| XLogP | 7.04 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|