C18H15F3N2O2S — CID 157021116
N-(5-phenyl-3,4-dihydro-1H-pyridin-2-ylidene)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 157021116) has the molecular formula C18H15F3N2O2S and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(5-phenyl-3,4-dihydro-1H-pyridin-2-ylidene)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(5-phenyl-3,4-dihydro-1H-pyridin-2-ylidene)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 157021116 |
| Molecular Formula | C18H15F3N2O2S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(5-phenyl-3,4-dihydro-1H-pyridin-2-ylidene)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(N=C1CCC(c2ccccc2)=CN1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N2O2S/c19-18(20,21)15-7-9-16(10-8-15)26(24,25)23-17-11-6-14(12-22-17)13-4-2-1-3-5-13/h1-5,7-10,12H,6,11H2,(H,22,23) |
| InChIKey | ZOAMGZZMSHCXAP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|